C27H38FN3 — CID 143065542
3-N-[3-[2-[4-(2-fluoropropan-2-yl)phenyl]-3-imino-1H-inden-2-yl]pentyl]butane-1,3-diamine (PubChem CID 143065542) has the molecular formula C27H38FN3 and a molecular weight of 423.62 g/mol. Its IUPAC name is 3-N-[3-[2-[4-(2-fluoropropan-2-yl)phenyl]-3-imino-1H-inden-2-yl]pentyl]butane-1,3-diamine.
| Compound Name | 3-N-[3-[2-[4-(2-fluoropropan-2-yl)phenyl]-3-imino-1H-inden-2-yl]pentyl]butane-1,3-diamine |
|---|---|
| PubChem CID | 143065542 |
| Molecular Formula | C27H38FN3 |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.30 |
| IUPAC Name | 3-N-[3-[2-[4-(2-fluoropropan-2-yl)phenyl]-3-imino-1H-inden-2-yl]pentyl]butane-1,3-diamine |
| SMILES | [H]/N=C1\c2ccccc2CC1(c1ccc(C(C)(C)F)cc1)C(CC)CCNC(C)CCN |
| InChI | InChI=1S/C27H38FN3/c1-5-21(15-17-31-19(2)14-16-29)27(18-20-8-6-7-9-24(20)25(27)30)23-12-10-22(11-13-23)26(3,4)28/h6-13,19,21,30-31H,5,14-18,29H2,1-4H3/b30-25+ |
| InChIKey | QVOHMUNHDIBQMT-QCWLDUFUSA-N |
| XLogP | 5.50 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|