C25H23F3N2O2S — CID 143065629
5-[2-(1,4-dimethyl-2,3-dihydro-1H-inden-5-yl)-1,3-thiazol-5-yl]-2-(2,2,2-trifluoroethoxy)benzonitrile;ethenol (PubChem CID 143065629) has the molecular formula C25H23F3N2O2S and a molecular weight of 472.53 g/mol. Its IUPAC name is 5-[2-(1,4-dimethyl-2,3-dihydro-1H-inden-5-yl)-1,3-thiazol-5-yl]-2-(2,2,2-trifluoroethoxy)benzonitrile;ethenol.
| Compound Name | 5-[2-(1,4-dimethyl-2,3-dihydro-1H-inden-5-yl)-1,3-thiazol-5-yl]-2-(2,2,2-trifluoroethoxy)benzonitrile;ethenol |
|---|---|
| PubChem CID | 143065629 |
| Molecular Formula | C25H23F3N2O2S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 5-[2-(1,4-dimethyl-2,3-dihydro-1H-inden-5-yl)-1,3-thiazol-5-yl]-2-(2,2,2-trifluoroethoxy)benzonitrile;ethenol |
| SMILES | C=CO.Cc1c(-c2ncc(-c3ccc(OCC(F)(F)F)c(C#N)c3)s2)ccc2c1CCC2C |
| InChI | InChI=1S/C23H19F3N2OS.C2H4O/c1-13-3-5-18-14(2)19(7-6-17(13)18)22-28-11-21(30-22)15-4-8-20(16(9-15)10-27)29-12-23(24,25)26;1-2-3/h4,6-9,11,13H,3,5,12H2,1-2H3;2-3H,1H2 |
| InChIKey | OVKZHOOIKVQDOI-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 66.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|