C13H15F3O3 — CID 143066031
methyl (2E,5Z,7E)-3-methyl-7-(trifluoromethoxy)deca-2,5,7,9-tetraenoate (PubChem CID 143066031) has the molecular formula C13H15F3O3 and a molecular weight of 276.25 g/mol. Its IUPAC name is methyl (2E,5Z,7E)-3-methyl-7-(trifluoromethoxy)deca-2,5,7,9-tetraenoate.
| Compound Name | methyl (2E,5Z,7E)-3-methyl-7-(trifluoromethoxy)deca-2,5,7,9-tetraenoate |
|---|---|
| PubChem CID | 143066031 |
| Molecular Formula | C13H15F3O3 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | methyl (2E,5Z,7E)-3-methyl-7-(trifluoromethoxy)deca-2,5,7,9-tetraenoate |
| SMILES | C=C/C=C(\C=C/C/C(C)=C/C(=O)OC)OC(F)(F)F |
| InChI | InChI=1S/C13H15F3O3/c1-4-6-11(19-13(14,15)16)8-5-7-10(2)9-12(17)18-3/h4-6,8-9H,1,7H2,2-3H3/b8-5-,10-9+,11-6+ |
| InChIKey | HSXVUKMVEFOSGS-NINSXORPSA-N |
| XLogP | 3.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|