C18H22N2O2 — CID 143066317
ethyl 1-[(2E)-2-methylpenta-2,4-dienyl]-5-phenyl-4,5-dihydroimidazole-4-carboxylate (PubChem CID 143066317) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is ethyl 1-[(2E)-2-methylpenta-2,4-dienyl]-5-phenyl-4,5-dihydroimidazole-4-carboxylate.
| Compound Name | ethyl 1-[(2E)-2-methylpenta-2,4-dienyl]-5-phenyl-4,5-dihydroimidazole-4-carboxylate |
|---|---|
| PubChem CID | 143066317 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | ethyl 1-[(2E)-2-methylpenta-2,4-dienyl]-5-phenyl-4,5-dihydroimidazole-4-carboxylate |
| SMILES | C=C/C=C(\C)CN1C=NC(C(=O)OCC)C1c1ccccc1 |
| InChI | InChI=1S/C18H22N2O2/c1-4-9-14(3)12-20-13-19-16(18(21)22-5-2)17(20)15-10-7-6-8-11-15/h4,6-11,13,16-17H,1,5,12H2,2-3H3/b14-9+ |
| InChIKey | CAGBJZSUKJKONT-NTEUORMPSA-N |
| XLogP | 3.14 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|