C12H23N3 — CID 143066321
ethane;(6E)-3,5,5-trimethyl-2H-azocine-7,8-diamine (PubChem CID 143066321) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is ethane;(6E)-3,5,5-trimethyl-2H-azocine-7,8-diamine.
| Compound Name | ethane;(6E)-3,5,5-trimethyl-2H-azocine-7,8-diamine |
|---|---|
| PubChem CID | 143066321 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | ethane;(6E)-3,5,5-trimethyl-2H-azocine-7,8-diamine |
| SMILES | CC.CC1=CC(C)(C)/C=C(N)\C(N)=N/C1 |
| InChI | InChI=1S/C10H17N3.C2H6/c1-7-4-10(2,3)5-8(11)9(12)13-6-7;1-2/h4-5H,6,11H2,1-3H3,(H2,12,13);1-2H3/b7-4?,8-5+; |
| InChIKey | RGYJRLNTVARBMD-XGOIPSATSA-N |
| XLogP | 2.20 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|