About 7-[(2R)-butan-2-yl]-1-pentyl-3,4-dihydro-2H-quinoline;4-(4-ethylphenyl)piperidine
7-[(2R)-butan-2-yl]-1-pentyl-3,4-dihydro-2H-quinoline;4-(4-ethylphenyl)piperidine (PubChem CID 143066340) has the molecular formula C31H48N2
and a molecular weight of 448.74 g/mol. Its IUPAC name is 7-[(2R)-butan-2-yl]-1-pentyl-3,4-dihydro-2H-quinoline;4-(4-ethylphenyl)piperidine.
Molecular Properties
| Compound Name | 7-[(2R)-butan-2-yl]-1-pentyl-3,4-dihydro-2H-quinoline;4-(4-ethylphenyl)piperidine |
| PubChem CID | 143066340 |
| Molecular Formula | C31H48N2 |
| Molecular Weight | 448.74 g/mol |
| Exact Mass | 448.38 |
| IUPAC Name | 7-[(2R)-butan-2-yl]-1-pentyl-3,4-dihydro-2H-quinoline;4-(4-ethylphenyl)piperidine |
| SMILES | CCCCCN1CCCc2ccc([C@H](C)CC)cc21.CCc1ccc(C2CCNCC2)cc1 |
| InChI | InChI=1S/C18H29N.C13H19N/c1-4-6-7-12-19-13-8-9-16-10-11-17(14-18(16)19)15(3)5-2;1-2-11-3-5-12(6-4-11)13-7-9-14-10-8-13/h10-11,14-15H,4-9,12-13H2,1-3H3;3-6,13-14H,2,7-10H2,1H3/t15-;/m1./s1 |
| InChIKey | LGCINBXMFBHSAJ-XFULWGLBSA-N |
| XLogP | 7.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.74 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[(2R)-butan-2-yl]-1-pentyl-3,4-dihydro-2H-quinoline;4-(4-ethylphenyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(2R)-butan-2-yl]-1-pentyl-3,4-dihydro-2H-quinoline;4-(4-ethylphenyl)piperidine?
The IUPAC name of 7-[(2R)-butan-2-yl]-1-pentyl-3,4-dihydro-2H-quinoline;4-(4-ethylphenyl)piperidine (CID 143066340) is 7-[(2R)-butan-2-yl]-1-pentyl-3,4-dihydro-2H-quinoline;4-(4-ethylphenyl)piperidine.
What is the SMILES notation for 7-[(2R)-butan-2-yl]-1-pentyl-3,4-dihydro-2H-quinoline;4-(4-ethylphenyl)piperidine?
The canonical SMILES for 7-[(2R)-butan-2-yl]-1-pentyl-3,4-dihydro-2H-quinoline;4-(4-ethylphenyl)piperidine is CCCCCN1CCCc2ccc([C@H](C)CC)cc21.CCc1ccc(C2CCNCC2)cc1.
What is the InChIKey of 7-[(2R)-butan-2-yl]-1-pentyl-3,4-dihydro-2H-quinoline;4-(4-ethylphenyl)piperidine?
The InChIKey is LGCINBXMFBHSAJ-XFULWGLBSA-N. The full InChI is InChI=1S/C18H29N.C13H19N/c1-4-6-7-12-19-13-8-9-16-10-11-17(14-18(16)19)15(3)5-2;1-2-11-3-5-12(6-4-11)13-7-9-14-10-8-13/h10-11,14-15H,4-9,12-13H2,1-3H3;3-6,13-14H,2,7-10H2,1H3/t15-;/m1./s1.
What are the key properties of 7-[(2R)-butan-2-yl]-1-pentyl-3,4-dihydro-2H-quinoline;4-(4-ethylphenyl)piperidine?
7-[(2R)-butan-2-yl]-1-pentyl-3,4-dihydro-2H-quinoline;4-(4-ethylphenyl)piperidine has a molecular weight of 448.74 g/mol, XLogP of 7.86, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(2R)-butan-2-yl]-1-pentyl-3,4-dihydro-2H-quinoline;4-(4-ethylphenyl)piperidine is sourced from PubChem (CID 143066340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).