C36H42N2O5 — CID 143066514
[4-[(3R,4R)-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-2,3,4,5-tetrahydropyridin-4-yl]phenyl]-(3-phenoxycyclopentyl)methanone (PubChem CID 143066514) has the molecular formula C36H42N2O5 and a molecular weight of 582.74 g/mol. Its IUPAC name is [4-[(3R,4R)-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-2,3,4,5-tetrahydropyridin-4-yl]phenyl]-(3-phenoxycyclopentyl)methanone.
| Compound Name | [4-[(3R,4R)-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-2,3,4,5-tetrahydropyridin-4-yl]phenyl]-(3-phenoxycyclopentyl)methanone |
|---|---|
| PubChem CID | 143066514 |
| Molecular Formula | C36H42N2O5 |
| Molecular Weight | 582.74 g/mol |
| Exact Mass | 582.31 |
| IUPAC Name | [4-[(3R,4R)-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-2,3,4,5-tetrahydropyridin-4-yl]phenyl]-(3-phenoxycyclopentyl)methanone |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CN=CC[C@@H]3c3ccc(C(=O)C4CCC(Oc5ccccc5)C4)cc3)cc21 |
| InChI | InChI=1S/C36H42N2O5/c1-40-20-5-18-38-19-21-41-34-15-8-26(22-33(34)38)25-42-35-24-37-17-16-32(35)27-9-11-28(12-10-27)36(39)29-13-14-31(23-29)43-30-6-3-2-4-7-30/h2-4,6-12,15,17,22,29,31-32,35H,5,13-14,16,18-21,23-25H2,1H3/t29?,31?,32-,35+/m1/s1 |
| InChIKey | CTYICZVQAFZNEQ-XBKDDCGJSA-N |
| XLogP | 6.50 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.74 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|