About 8-(2-methylpropyl)-5,6-dihydroquinoline
8-(2-methylpropyl)-5,6-dihydroquinoline (PubChem CID 143067849) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is 8-(2-methylpropyl)-5,6-dihydroquinoline.
Molecular Properties
| Compound Name | 8-(2-methylpropyl)-5,6-dihydroquinoline |
| PubChem CID | 143067849 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 8-(2-methylpropyl)-5,6-dihydroquinoline |
| SMILES | CC(C)CC1=CCCc2cccnc21 |
| InChI | InChI=1S/C13H17N/c1-10(2)9-12-6-3-5-11-7-4-8-14-13(11)12/h4,6-8,10H,3,5,9H2,1-2H3 |
| InChIKey | RQUFHQKCSMDFJR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-(2-methylpropyl)-5,6-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2-methylpropyl)-5,6-dihydroquinoline?
The IUPAC name of 8-(2-methylpropyl)-5,6-dihydroquinoline (CID 143067849) is 8-(2-methylpropyl)-5,6-dihydroquinoline.
What is the SMILES notation for 8-(2-methylpropyl)-5,6-dihydroquinoline?
The canonical SMILES for 8-(2-methylpropyl)-5,6-dihydroquinoline is CC(C)CC1=CCCc2cccnc21.
What is the InChIKey of 8-(2-methylpropyl)-5,6-dihydroquinoline?
The InChIKey is RQUFHQKCSMDFJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N/c1-10(2)9-12-6-3-5-11-7-4-8-14-13(11)12/h4,6-8,10H,3,5,9H2,1-2H3.
What are the key properties of 8-(2-methylpropyl)-5,6-dihydroquinoline?
8-(2-methylpropyl)-5,6-dihydroquinoline has a molecular weight of 187.29 g/mol, XLogP of 3.46, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2-methylpropyl)-5,6-dihydroquinoline is sourced from PubChem (CID 143067849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).