About 4-amino-5-[(E)-2-(1,2-dihydropyridin-5-yl)ethenyl]-1H-pyrimidin-6-one
4-amino-5-[(E)-2-(1,2-dihydropyridin-5-yl)ethenyl]-1H-pyrimidin-6-one (PubChem CID 143068559) has the molecular formula C11H12N4O
and a molecular weight of 216.24 g/mol. Its IUPAC name is 4-amino-5-[(E)-2-(1,2-dihydropyridin-5-yl)ethenyl]-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-amino-5-[(E)-2-(1,2-dihydropyridin-5-yl)ethenyl]-1H-pyrimidin-6-one |
| PubChem CID | 143068559 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 4-amino-5-[(E)-2-(1,2-dihydropyridin-5-yl)ethenyl]-1H-pyrimidin-6-one |
| SMILES | Nc1nc[nH]c(=O)c1/C=C/C1=CNCC=C1 |
| InChI | InChI=1S/C11H12N4O/c12-10-9(11(16)15-7-14-10)4-3-8-2-1-5-13-6-8/h1-4,6-7,13H,5H2,(H3,12,14,15,16)/b4-3+ |
| InChIKey | NMVCJCCPEPNSIM-ONEGZZNKSA-N |
| XLogP | 0.41 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-5-[(E)-2-(1,2-dihydropyridin-5-yl)ethenyl]-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5-[(E)-2-(1,2-dihydropyridin-5-yl)ethenyl]-1H-pyrimidin-6-one?
The IUPAC name of 4-amino-5-[(E)-2-(1,2-dihydropyridin-5-yl)ethenyl]-1H-pyrimidin-6-one (CID 143068559) is 4-amino-5-[(E)-2-(1,2-dihydropyridin-5-yl)ethenyl]-1H-pyrimidin-6-one.
What is the SMILES notation for 4-amino-5-[(E)-2-(1,2-dihydropyridin-5-yl)ethenyl]-1H-pyrimidin-6-one?
The canonical SMILES for 4-amino-5-[(E)-2-(1,2-dihydropyridin-5-yl)ethenyl]-1H-pyrimidin-6-one is Nc1nc[nH]c(=O)c1/C=C/C1=CNCC=C1.
What is the InChIKey of 4-amino-5-[(E)-2-(1,2-dihydropyridin-5-yl)ethenyl]-1H-pyrimidin-6-one?
The InChIKey is NMVCJCCPEPNSIM-ONEGZZNKSA-N. The full InChI is InChI=1S/C11H12N4O/c12-10-9(11(16)15-7-14-10)4-3-8-2-1-5-13-6-8/h1-4,6-7,13H,5H2,(H3,12,14,15,16)/b4-3+.
What are the key properties of 4-amino-5-[(E)-2-(1,2-dihydropyridin-5-yl)ethenyl]-1H-pyrimidin-6-one?
4-amino-5-[(E)-2-(1,2-dihydropyridin-5-yl)ethenyl]-1H-pyrimidin-6-one has a molecular weight of 216.24 g/mol, XLogP of 0.41, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5-[(E)-2-(1,2-dihydropyridin-5-yl)ethenyl]-1H-pyrimidin-6-one is sourced from PubChem (CID 143068559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).