C17H15ClFNO2 — CID 143068646
3-[4-[4-(chloromethyl)phenyl]-3-fluorophenyl]-5-methyl-1,3-oxazolidin-2-one (PubChem CID 143068646) has the molecular formula C17H15ClFNO2 and a molecular weight of 319.76 g/mol. Its IUPAC name is 3-[4-[4-(chloromethyl)phenyl]-3-fluorophenyl]-5-methyl-1,3-oxazolidin-2-one.
| Compound Name | 3-[4-[4-(chloromethyl)phenyl]-3-fluorophenyl]-5-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 143068646 |
| Molecular Formula | C17H15ClFNO2 |
| Molecular Weight | 319.76 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 3-[4-[4-(chloromethyl)phenyl]-3-fluorophenyl]-5-methyl-1,3-oxazolidin-2-one |
| SMILES | CC1CN(c2ccc(-c3ccc(CCl)cc3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H15ClFNO2/c1-11-10-20(17(21)22-11)14-6-7-15(16(19)8-14)13-4-2-12(9-18)3-5-13/h2-8,11H,9-10H2,1H3 |
| InChIKey | JNNDPPNETLKNJB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.76 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|