C17H26ClN3O2S — CID 14306891
2,2,5,5-tetramethyl-N-[3-(thiophene-2-carbonylamino)propyl]-1H-pyrrole-3-carboxamide;hydrochloride (PubChem CID 14306891) has the molecular formula C17H26ClN3O2S and a molecular weight of 371.93 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-N-[3-(thiophene-2-carbonylamino)propyl]-1H-pyrrole-3-carboxamide;hydrochloride.
| Compound Name | 2,2,5,5-tetramethyl-N-[3-(thiophene-2-carbonylamino)propyl]-1H-pyrrole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 14306891 |
| Molecular Formula | C17H26ClN3O2S |
| Molecular Weight | 371.93 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2,2,5,5-tetramethyl-N-[3-(thiophene-2-carbonylamino)propyl]-1H-pyrrole-3-carboxamide;hydrochloride |
| SMILES | CC1(C)C=C(C(=O)NCCCNC(=O)c2cccs2)C(C)(C)N1.Cl |
| InChI | InChI=1S/C17H25N3O2S.ClH/c1-16(2)11-12(17(3,4)20-16)14(21)18-8-6-9-19-15(22)13-7-5-10-23-13;/h5,7,10-11,20H,6,8-9H2,1-4H3,(H,18,21)(H,19,22);1H |
| InChIKey | DUJPCDGQTQHWTO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.93 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|