C24H35N3O3 — CID 14306906
2,2,5,5-tetramethyl-N-[3-[[2-(4-methyl-2-prop-2-enylphenoxy)acetyl]amino]propyl]-1H-pyrrole-3-carboxamide (PubChem CID 14306906) has the molecular formula C24H35N3O3 and a molecular weight of 413.56 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-N-[3-[[2-(4-methyl-2-prop-2-enylphenoxy)acetyl]amino]propyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 2,2,5,5-tetramethyl-N-[3-[[2-(4-methyl-2-prop-2-enylphenoxy)acetyl]amino]propyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 14306906 |
| Molecular Formula | C24H35N3O3 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | 2,2,5,5-tetramethyl-N-[3-[[2-(4-methyl-2-prop-2-enylphenoxy)acetyl]amino]propyl]-1H-pyrrole-3-carboxamide |
| SMILES | C=CCc1cc(C)ccc1OCC(=O)NCCCNC(=O)C1=CC(C)(C)NC1(C)C |
| InChI | InChI=1S/C24H35N3O3/c1-7-9-18-14-17(2)10-11-20(18)30-16-21(28)25-12-8-13-26-22(29)19-15-23(3,4)27-24(19,5)6/h7,10-11,14-15,27H,1,8-9,12-13,16H2,2-6H3,(H,25,28)(H,26,29) |
| InChIKey | YCVHNJLNGLKACX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|