C12H17F3S — CID 143069176
(3Z,5E)-1,1,1-trifluoro-2-methyl-5-(1-methylsulfanylethenyl)octa-3,5-diene (PubChem CID 143069176) has the molecular formula C12H17F3S and a molecular weight of 250.33 g/mol. Its IUPAC name is (3Z,5E)-1,1,1-trifluoro-2-methyl-5-(1-methylsulfanylethenyl)octa-3,5-diene.
| Compound Name | (3Z,5E)-1,1,1-trifluoro-2-methyl-5-(1-methylsulfanylethenyl)octa-3,5-diene |
|---|---|
| PubChem CID | 143069176 |
| Molecular Formula | C12H17F3S |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (3Z,5E)-1,1,1-trifluoro-2-methyl-5-(1-methylsulfanylethenyl)octa-3,5-diene |
| SMILES | C=C(SC)C(/C=C\C(C)C(F)(F)F)=C/CC |
| InChI | InChI=1S/C12H17F3S/c1-5-6-11(10(3)16-4)8-7-9(2)12(13,14)15/h6-9H,3,5H2,1-2,4H3/b8-7-,11-6+ |
| InChIKey | MXMTXZNFDVVPNS-YKFSIMETSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|