C29H38F3NO2 — CID 143069294
3-methylbut-3-ene-1,1-diol;2-methyl-N-[1-[4-(trifluoromethyl)phenyl]ethenyl]-5-(2,3,6-trimethylphenyl)pent-2-en-3-amine (PubChem CID 143069294) has the molecular formula C29H38F3NO2 and a molecular weight of 489.62 g/mol. Its IUPAC name is 3-methylbut-3-ene-1,1-diol;2-methyl-N-[1-[4-(trifluoromethyl)phenyl]ethenyl]-5-(2,3,6-trimethylphenyl)pent-2-en-3-amine.
| Compound Name | 3-methylbut-3-ene-1,1-diol;2-methyl-N-[1-[4-(trifluoromethyl)phenyl]ethenyl]-5-(2,3,6-trimethylphenyl)pent-2-en-3-amine |
|---|---|
| PubChem CID | 143069294 |
| Molecular Formula | C29H38F3NO2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | 3-methylbut-3-ene-1,1-diol;2-methyl-N-[1-[4-(trifluoromethyl)phenyl]ethenyl]-5-(2,3,6-trimethylphenyl)pent-2-en-3-amine |
| SMILES | C=C(C)CC(O)O.C=C(NC(CCc1c(C)ccc(C)c1C)=C(C)C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H28F3N.C5H10O2/c1-15(2)23(14-13-22-17(4)8-7-16(3)18(22)5)28-19(6)20-9-11-21(12-10-20)24(25,26)27;1-4(2)3-5(6)7/h7-12,28H,6,13-14H2,1-5H3;5-7H,1,3H2,2H3 |
| InChIKey | YXDOMDPZLHAZTD-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|