C20H22F3NO — CID 143069905
(5R)-9-(difluoromethyl)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline;fluoromethane (PubChem CID 143069905) has the molecular formula C20H22F3NO and a molecular weight of 349.40 g/mol. Its IUPAC name is (5R)-9-(difluoromethyl)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline;fluoromethane.
| Compound Name | (5R)-9-(difluoromethyl)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline;fluoromethane |
|---|---|
| PubChem CID | 143069905 |
| Molecular Formula | C20H22F3NO |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | (5R)-9-(difluoromethyl)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline;fluoromethane |
| SMILES | CF.FC(F)c1ccc2c(c1)C1OCCCC1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C19H19F2NO.CH3F/c20-19(21)13-8-9-16-15(11-13)18-14(7-4-10-23-18)17(22-16)12-5-2-1-3-6-12;1-2/h1-3,5-6,8-9,11,14,17-19,22H,4,7,10H2;1H3/t14?,17-,18?;/m0./s1 |
| InChIKey | HIBFHMIOUNGYBF-KXINBIKJSA-N |
| XLogP | 5.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |