C28H35F2N3O3 — CID 143069911
propan-2-yl 4-[[(5R)-9-(difluoromethyl)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperazine-1-carboxylate (PubChem CID 143069911) has the molecular formula C28H35F2N3O3 and a molecular weight of 499.60 g/mol. Its IUPAC name is propan-2-yl 4-[[(5R)-9-(difluoromethyl)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperazine-1-carboxylate.
| Compound Name | propan-2-yl 4-[[(5R)-9-(difluoromethyl)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 143069911 |
| Molecular Formula | C28H35F2N3O3 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | propan-2-yl 4-[[(5R)-9-(difluoromethyl)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)OC(=O)N1CCN(CC2CCC3C(O2)c2cc(C(F)F)ccc2N[C@H]3c2ccccc2)CC1 |
| InChI | InChI=1S/C28H35F2N3O3/c1-18(2)35-28(34)33-14-12-32(13-15-33)17-21-9-10-22-25(19-6-4-3-5-7-19)31-24-11-8-20(27(29)30)16-23(24)26(22)36-21/h3-8,11,16,18,21-22,25-27,31H,9-10,12-15,17H2,1-2H3/t21?,22?,25-,26?/m0/s1 |
| InChIKey | XJCNRJFIOVFFIS-YWSJGMOJSA-N |
| XLogP | 5.79 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |