C21H23F2NO — CID 143069918
8-tert-butyl-4-(2,5-difluorophenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline (PubChem CID 143069918) has the molecular formula C21H23F2NO and a molecular weight of 343.42 g/mol. Its IUPAC name is 8-tert-butyl-4-(2,5-difluorophenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline.
| Compound Name | 8-tert-butyl-4-(2,5-difluorophenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline |
|---|---|
| PubChem CID | 143069918 |
| Molecular Formula | C21H23F2NO |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 8-tert-butyl-4-(2,5-difluorophenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline |
| SMILES | CC(C)(C)c1ccc2c(c1)C1OCCC1C(c1cc(F)ccc1F)N2 |
| InChI | InChI=1S/C21H23F2NO/c1-21(2,3)12-4-7-18-16(10-12)20-14(8-9-25-20)19(24-18)15-11-13(22)5-6-17(15)23/h4-7,10-11,14,19-20,24H,8-9H2,1-3H3 |
| InChIKey | MTHGKAGSWHUPIG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |