C27H33F2N3O3 — CID 143070044
[(5R)-9-(difluoromethyl)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl 4-ethylpiperazine-1-carboxylate (PubChem CID 143070044) has the molecular formula C27H33F2N3O3 and a molecular weight of 485.58 g/mol. Its IUPAC name is [(5R)-9-(difluoromethyl)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl 4-ethylpiperazine-1-carboxylate.
| Compound Name | [(5R)-9-(difluoromethyl)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl 4-ethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 143070044 |
| Molecular Formula | C27H33F2N3O3 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | [(5R)-9-(difluoromethyl)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl 4-ethylpiperazine-1-carboxylate |
| SMILES | CCN1CCN(C(=O)OCC2CCC3C(O2)c2cc(C(F)F)ccc2N[C@H]3c2ccccc2)CC1 |
| InChI | InChI=1S/C27H33F2N3O3/c1-2-31-12-14-32(15-13-31)27(33)34-17-20-9-10-21-24(18-6-4-3-5-7-18)30-23-11-8-19(26(28)29)16-22(23)25(21)35-20/h3-8,11,16,20-21,24-26,30H,2,9-10,12-15,17H2,1H3/t20?,21?,24-,25?/m0/s1 |
| InChIKey | OFOKWFWCWDCUBO-REDLIUDKSA-N |
| XLogP | 5.40 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |