C17H17F2NO2S — CID 143070144
5-[(5R)-9-(difluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]thiophen-2-ol (PubChem CID 143070144) has the molecular formula C17H17F2NO2S and a molecular weight of 337.39 g/mol. Its IUPAC name is 5-[(5R)-9-(difluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]thiophen-2-ol.
| Compound Name | 5-[(5R)-9-(difluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]thiophen-2-ol |
|---|---|
| PubChem CID | 143070144 |
| Molecular Formula | C17H17F2NO2S |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 5-[(5R)-9-(difluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]thiophen-2-ol |
| SMILES | Oc1ccc([C@@H]2Nc3ccc(C(F)F)cc3C3OCCCC32)s1 |
| InChI | InChI=1S/C17H17F2NO2S/c18-17(19)9-3-4-12-11(8-9)16-10(2-1-7-22-16)15(20-12)13-5-6-14(21)23-13/h3-6,8,10,15-17,20-21H,1-2,7H2/t10?,15-,16?/m1/s1 |
| InChIKey | FMVUBCMEEOVCSI-KRSWERPXSA-N |
| XLogP | 5.03 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |