C26H32F2N2O2 — CID 143070145
(5R)-9-(difluoromethyl)-2-[(1-methylpiperidin-4-yl)oxymethyl]-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 143070145) has the molecular formula C26H32F2N2O2 and a molecular weight of 442.55 g/mol. Its IUPAC name is (5R)-9-(difluoromethyl)-2-[(1-methylpiperidin-4-yl)oxymethyl]-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (5R)-9-(difluoromethyl)-2-[(1-methylpiperidin-4-yl)oxymethyl]-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 143070145 |
| Molecular Formula | C26H32F2N2O2 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | (5R)-9-(difluoromethyl)-2-[(1-methylpiperidin-4-yl)oxymethyl]-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | CN1CCC(OCC2CCC3C(O2)c2cc(C(F)F)ccc2N[C@H]3c2ccccc2)CC1 |
| InChI | InChI=1S/C26H32F2N2O2/c1-30-13-11-19(12-14-30)31-16-20-8-9-21-24(17-5-3-2-4-6-17)29-23-10-7-18(26(27)28)15-22(23)25(21)32-20/h2-7,10,15,19-21,24-26,29H,8-9,11-14,16H2,1H3/t20?,21?,24-,25?/m0/s1 |
| InChIKey | NXRXZMYLCSZKSF-REDLIUDKSA-N |
| XLogP | 5.74 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |