C25H37ClN2O — CID 143070151
4-(6-tert-butyl-4-methoxy-3-propyl-1,2,3,4-tetrahydroquinolin-2-yl)-2-chloroaniline;ethane (PubChem CID 143070151) has the molecular formula C25H37ClN2O and a molecular weight of 417.04 g/mol. Its IUPAC name is 4-(6-tert-butyl-4-methoxy-3-propyl-1,2,3,4-tetrahydroquinolin-2-yl)-2-chloroaniline;ethane.
| Compound Name | 4-(6-tert-butyl-4-methoxy-3-propyl-1,2,3,4-tetrahydroquinolin-2-yl)-2-chloroaniline;ethane |
|---|---|
| PubChem CID | 143070151 |
| Molecular Formula | C25H37ClN2O |
| Molecular Weight | 417.04 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 4-(6-tert-butyl-4-methoxy-3-propyl-1,2,3,4-tetrahydroquinolin-2-yl)-2-chloroaniline;ethane |
| SMILES | CC.CCCC1C(c2ccc(N)c(Cl)c2)Nc2ccc(C(C)(C)C)cc2C1OC |
| InChI | InChI=1S/C23H31ClN2O.C2H6/c1-6-7-16-21(14-8-10-19(25)18(24)12-14)26-20-11-9-15(23(2,3)4)13-17(20)22(16)27-5;1-2/h8-13,16,21-22,26H,6-7,25H2,1-5H3;1-2H3 |
| InChIKey | LPBQVVZATWGTNQ-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.04 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|