About 2-cyclohepta-1,3,5-trien-1-yloxy-N-ethyl-N-methylethanamine
2-cyclohepta-1,3,5-trien-1-yloxy-N-ethyl-N-methylethanamine (PubChem CID 143070406) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-cyclohepta-1,3,5-trien-1-yloxy-N-ethyl-N-methylethanamine.
Molecular Properties
| Compound Name | 2-cyclohepta-1,3,5-trien-1-yloxy-N-ethyl-N-methylethanamine |
| PubChem CID | 143070406 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 2-cyclohepta-1,3,5-trien-1-yloxy-N-ethyl-N-methylethanamine |
| SMILES | CCN(C)CCOC1=CC=CC=CC1 |
| InChI | InChI=1S/C12H19NO/c1-3-13(2)10-11-14-12-8-6-4-5-7-9-12/h4-8H,3,9-11H2,1-2H3 |
| InChIKey | QCEKCDBWYSEVNR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclohepta-1,3,5-trien-1-yloxy-N-ethyl-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohepta-1,3,5-trien-1-yloxy-N-ethyl-N-methylethanamine?
The IUPAC name of 2-cyclohepta-1,3,5-trien-1-yloxy-N-ethyl-N-methylethanamine (CID 143070406) is 2-cyclohepta-1,3,5-trien-1-yloxy-N-ethyl-N-methylethanamine.
What is the SMILES notation for 2-cyclohepta-1,3,5-trien-1-yloxy-N-ethyl-N-methylethanamine?
The canonical SMILES for 2-cyclohepta-1,3,5-trien-1-yloxy-N-ethyl-N-methylethanamine is CCN(C)CCOC1=CC=CC=CC1.
What is the InChIKey of 2-cyclohepta-1,3,5-trien-1-yloxy-N-ethyl-N-methylethanamine?
The InChIKey is QCEKCDBWYSEVNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-3-13(2)10-11-14-12-8-6-4-5-7-9-12/h4-8H,3,9-11H2,1-2H3.
What are the key properties of 2-cyclohepta-1,3,5-trien-1-yloxy-N-ethyl-N-methylethanamine?
2-cyclohepta-1,3,5-trien-1-yloxy-N-ethyl-N-methylethanamine has a molecular weight of 193.29 g/mol, XLogP of 2.35, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohepta-1,3,5-trien-1-yloxy-N-ethyl-N-methylethanamine is sourced from PubChem (CID 143070406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).