C24H43FN2 — CID 143071683
1-(4-fluorobutyl)-4-[(2E,4Z)-3-(3,3,5,5-tetramethylcyclohexyl)hexa-2,4-dien-2-yl]piperazine (PubChem CID 143071683) has the molecular formula C24H43FN2 and a molecular weight of 378.62 g/mol. Its IUPAC name is 1-(4-fluorobutyl)-4-[(2E,4Z)-3-(3,3,5,5-tetramethylcyclohexyl)hexa-2,4-dien-2-yl]piperazine.
| Compound Name | 1-(4-fluorobutyl)-4-[(2E,4Z)-3-(3,3,5,5-tetramethylcyclohexyl)hexa-2,4-dien-2-yl]piperazine |
|---|---|
| PubChem CID | 143071683 |
| Molecular Formula | C24H43FN2 |
| Molecular Weight | 378.62 g/mol |
| Exact Mass | 378.34 |
| IUPAC Name | 1-(4-fluorobutyl)-4-[(2E,4Z)-3-(3,3,5,5-tetramethylcyclohexyl)hexa-2,4-dien-2-yl]piperazine |
| SMILES | C/C=C\C(=C(/C)N1CCN(CCCCF)CC1)C1CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C24H43FN2/c1-7-10-22(21-17-23(3,4)19-24(5,6)18-21)20(2)27-15-13-26(14-16-27)12-9-8-11-25/h7,10,21H,8-9,11-19H2,1-6H3/b10-7-,22-20- |
| InChIKey | VYPFTYNJXFXJGL-UFECBATCSA-N |
| XLogP | 6.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.62 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|