C24H38N2 — CID 143071724
1-[(2Z)-6-(cyclohepten-1-yl)octa-2,4,5,7-tetraen-4-yl]-4-pentylpiperazine (PubChem CID 143071724) has the molecular formula C24H38N2 and a molecular weight of 354.58 g/mol. Its IUPAC name is 1-[(2Z)-6-(cyclohepten-1-yl)octa-2,4,5,7-tetraen-4-yl]-4-pentylpiperazine.
| Compound Name | 1-[(2Z)-6-(cyclohepten-1-yl)octa-2,4,5,7-tetraen-4-yl]-4-pentylpiperazine |
|---|---|
| PubChem CID | 143071724 |
| Molecular Formula | C24H38N2 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.30 |
| IUPAC Name | 1-[(2Z)-6-(cyclohepten-1-yl)octa-2,4,5,7-tetraen-4-yl]-4-pentylpiperazine |
| SMILES | C=CC(=C=C(/C=C\C)N1CCN(CCCCC)CC1)C1=CCCCCC1 |
| InChI | InChI=1S/C24H38N2/c1-4-7-12-16-25-17-19-26(20-18-25)24(13-5-2)21-22(6-3)23-14-10-8-9-11-15-23/h5-6,13-14H,3-4,7-12,15-20H2,1-2H3/b13-5- |
| InChIKey | KVGYOPRCQLTMJM-ACAGNQJTSA-N |
| XLogP | 5.86 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|