C8H10F3N — CID 143072411
N-[(2Z,4E)-1,1,1-trifluorohexa-2,4-dien-2-yl]ethanimine (PubChem CID 143072411) has the molecular formula C8H10F3N and a molecular weight of 177.17 g/mol. Its IUPAC name is N-[(2Z,4E)-1,1,1-trifluorohexa-2,4-dien-2-yl]ethanimine.
| Compound Name | N-[(2Z,4E)-1,1,1-trifluorohexa-2,4-dien-2-yl]ethanimine |
|---|---|
| PubChem CID | 143072411 |
| Molecular Formula | C8H10F3N |
| Molecular Weight | 177.17 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | N-[(2Z,4E)-1,1,1-trifluorohexa-2,4-dien-2-yl]ethanimine |
| SMILES | C/C=C/C=C(\N=C\C)C(F)(F)F |
| InChI | InChI=1S/C8H10F3N/c1-3-5-6-7(12-4-2)8(9,10)11/h3-6H,1-2H3/b5-3+,7-6-,12-4+ |
| InChIKey | TVPPEPMBAFQIGN-YROHVBBBSA-N |
| XLogP | 3.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.17 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|