C14H22ClNO — CID 143072453
N-[(2-chlorophenyl)methyl]-N,2-dimethylpropanamide;ethane (PubChem CID 143072453) has the molecular formula C14H22ClNO and a molecular weight of 255.79 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N,2-dimethylpropanamide;ethane.
| Compound Name | N-[(2-chlorophenyl)methyl]-N,2-dimethylpropanamide;ethane |
|---|---|
| PubChem CID | 143072453 |
| Molecular Formula | C14H22ClNO |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N,2-dimethylpropanamide;ethane |
| SMILES | CC.CC(C)C(=O)N(C)Cc1ccccc1Cl |
| InChI | InChI=1S/C12H16ClNO.C2H6/c1-9(2)12(15)14(3)8-10-6-4-5-7-11(10)13;1-2/h4-7,9H,8H2,1-3H3;1-2H3 |
| InChIKey | AWQJFHGBUQCIRN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |