About 1-methyl-5-[5-[(E)-prop-1-enyl]cyclohepta-1,4,6-trien-1-yl]indole
1-methyl-5-[5-[(E)-prop-1-enyl]cyclohepta-1,4,6-trien-1-yl]indole (PubChem CID 143072506) has the molecular formula C19H19N
and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-methyl-5-[5-[(E)-prop-1-enyl]cyclohepta-1,4,6-trien-1-yl]indole.
Molecular Properties
| Compound Name | 1-methyl-5-[5-[(E)-prop-1-enyl]cyclohepta-1,4,6-trien-1-yl]indole |
| PubChem CID | 143072506 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1-methyl-5-[5-[(E)-prop-1-enyl]cyclohepta-1,4,6-trien-1-yl]indole |
| SMILES | C/C=C/C1=CCC=C(c2ccc3c(ccn3C)c2)C=C1 |
| InChI | InChI=1S/C19H19N/c1-3-5-15-6-4-7-16(9-8-15)17-10-11-19-18(14-17)12-13-20(19)2/h3,5-14H,4H2,1-2H3/b5-3+ |
| InChIKey | AWEYDYMQRTZVRE-HWKANZROSA-N |
| XLogP | 5.02 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-5-[5-[(E)-prop-1-enyl]cyclohepta-1,4,6-trien-1-yl]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5-[5-[(E)-prop-1-enyl]cyclohepta-1,4,6-trien-1-yl]indole?
The IUPAC name of 1-methyl-5-[5-[(E)-prop-1-enyl]cyclohepta-1,4,6-trien-1-yl]indole (CID 143072506) is 1-methyl-5-[5-[(E)-prop-1-enyl]cyclohepta-1,4,6-trien-1-yl]indole.
What is the SMILES notation for 1-methyl-5-[5-[(E)-prop-1-enyl]cyclohepta-1,4,6-trien-1-yl]indole?
The canonical SMILES for 1-methyl-5-[5-[(E)-prop-1-enyl]cyclohepta-1,4,6-trien-1-yl]indole is C/C=C/C1=CCC=C(c2ccc3c(ccn3C)c2)C=C1.
What is the InChIKey of 1-methyl-5-[5-[(E)-prop-1-enyl]cyclohepta-1,4,6-trien-1-yl]indole?
The InChIKey is AWEYDYMQRTZVRE-HWKANZROSA-N. The full InChI is InChI=1S/C19H19N/c1-3-5-15-6-4-7-16(9-8-15)17-10-11-19-18(14-17)12-13-20(19)2/h3,5-14H,4H2,1-2H3/b5-3+.
What are the key properties of 1-methyl-5-[5-[(E)-prop-1-enyl]cyclohepta-1,4,6-trien-1-yl]indole?
1-methyl-5-[5-[(E)-prop-1-enyl]cyclohepta-1,4,6-trien-1-yl]indole has a molecular weight of 261.37 g/mol, XLogP of 5.02, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5-[5-[(E)-prop-1-enyl]cyclohepta-1,4,6-trien-1-yl]indole is sourced from PubChem (CID 143072506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).