About 6-[(2-methyl-3,4-dihydro-2H-chromen-6-yl)oxy]pyridin-3-amine
6-[(2-methyl-3,4-dihydro-2H-chromen-6-yl)oxy]pyridin-3-amine (PubChem CID 14307268) has the molecular formula C15H16N2O2
and a molecular weight of 256.31 g/mol. Its IUPAC name is 6-[(2-methyl-3,4-dihydro-2H-chromen-6-yl)oxy]pyridin-3-amine.
Molecular Properties
| Compound Name | 6-[(2-methyl-3,4-dihydro-2H-chromen-6-yl)oxy]pyridin-3-amine |
| PubChem CID | 14307268 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 6-[(2-methyl-3,4-dihydro-2H-chromen-6-yl)oxy]pyridin-3-amine |
| SMILES | CC1CCc2cc(Oc3ccc(N)cn3)ccc2O1 |
| InChI | InChI=1S/C15H16N2O2/c1-10-2-3-11-8-13(5-6-14(11)18-10)19-15-7-4-12(16)9-17-15/h4-10H,2-3,16H2,1H3 |
| InChIKey | VWRWHGHXAICPDA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_A(8)', 'substructure': 'N/A'} |
|---|
Analyze 6-[(2-methyl-3,4-dihydro-2H-chromen-6-yl)oxy]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2-methyl-3,4-dihydro-2H-chromen-6-yl)oxy]pyridin-3-amine?
The IUPAC name of 6-[(2-methyl-3,4-dihydro-2H-chromen-6-yl)oxy]pyridin-3-amine (CID 14307268) is 6-[(2-methyl-3,4-dihydro-2H-chromen-6-yl)oxy]pyridin-3-amine.
What is the SMILES notation for 6-[(2-methyl-3,4-dihydro-2H-chromen-6-yl)oxy]pyridin-3-amine?
The canonical SMILES for 6-[(2-methyl-3,4-dihydro-2H-chromen-6-yl)oxy]pyridin-3-amine is CC1CCc2cc(Oc3ccc(N)cn3)ccc2O1.
What is the InChIKey of 6-[(2-methyl-3,4-dihydro-2H-chromen-6-yl)oxy]pyridin-3-amine?
The InChIKey is VWRWHGHXAICPDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O2/c1-10-2-3-11-8-13(5-6-14(11)18-10)19-15-7-4-12(16)9-17-15/h4-10H,2-3,16H2,1H3.
What are the key properties of 6-[(2-methyl-3,4-dihydro-2H-chromen-6-yl)oxy]pyridin-3-amine?
6-[(2-methyl-3,4-dihydro-2H-chromen-6-yl)oxy]pyridin-3-amine has a molecular weight of 256.31 g/mol, XLogP of 3.17, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2-methyl-3,4-dihydro-2H-chromen-6-yl)oxy]pyridin-3-amine is sourced from PubChem (CID 14307268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).