C23H26ClNO4 — CID 143072680
tert-butyl N-[(3S)-5-chloro-4-oxo-2-(4-phenylmethoxyphenyl)pent-1-en-3-yl]carbamate (PubChem CID 143072680) has the molecular formula C23H26ClNO4 and a molecular weight of 415.92 g/mol. Its IUPAC name is tert-butyl N-[(3S)-5-chloro-4-oxo-2-(4-phenylmethoxyphenyl)pent-1-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-5-chloro-4-oxo-2-(4-phenylmethoxyphenyl)pent-1-en-3-yl]carbamate |
|---|---|
| PubChem CID | 143072680 |
| Molecular Formula | C23H26ClNO4 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | tert-butyl N-[(3S)-5-chloro-4-oxo-2-(4-phenylmethoxyphenyl)pent-1-en-3-yl]carbamate |
| SMILES | C=C(c1ccc(OCc2ccccc2)cc1)[C@H](NC(=O)OC(C)(C)C)C(=O)CCl |
| InChI | InChI=1S/C23H26ClNO4/c1-16(21(20(26)14-24)25-22(27)29-23(2,3)4)18-10-12-19(13-11-18)28-15-17-8-6-5-7-9-17/h5-13,21H,1,14-15H2,2-4H3,(H,25,27)/t21-/m0/s1 |
| InChIKey | IKEILMUQOUBXBZ-NRFANRHFSA-N |
| XLogP | 4.98 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|