C16H36N2O2 — CID 143072952
tert-butyl N-(cyclohexylmethylamino)carbamate;ethane (PubChem CID 143072952) has the molecular formula C16H36N2O2 and a molecular weight of 288.48 g/mol. Its IUPAC name is tert-butyl N-(cyclohexylmethylamino)carbamate;ethane.
| Compound Name | tert-butyl N-(cyclohexylmethylamino)carbamate;ethane |
|---|---|
| PubChem CID | 143072952 |
| Molecular Formula | C16H36N2O2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.28 |
| IUPAC Name | tert-butyl N-(cyclohexylmethylamino)carbamate;ethane |
| SMILES | CC.CC.CC(C)(C)OC(=O)NNCC1CCCCC1 |
| InChI | InChI=1S/C12H24N2O2.2C2H6/c1-12(2,3)16-11(15)14-13-9-10-7-5-4-6-8-10;2*1-2/h10,13H,4-9H2,1-3H3,(H,14,15);2*1-2H3 |
| InChIKey | SCSZNMPOBYGPFG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|