C20H28O2 — CID 143073076
(3E,5E,7E,8Z,10Z)-7-ethylidene-4-methoxy-5-(2-methylprop-2-enylidene)dodeca-1,3,8,10-tetraen-6-one;methane (PubChem CID 143073076) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (3E,5E,7E,8Z,10Z)-7-ethylidene-4-methoxy-5-(2-methylprop-2-enylidene)dodeca-1,3,8,10-tetraen-6-one;methane.
| Compound Name | (3E,5E,7E,8Z,10Z)-7-ethylidene-4-methoxy-5-(2-methylprop-2-enylidene)dodeca-1,3,8,10-tetraen-6-one;methane |
|---|---|
| PubChem CID | 143073076 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (3E,5E,7E,8Z,10Z)-7-ethylidene-4-methoxy-5-(2-methylprop-2-enylidene)dodeca-1,3,8,10-tetraen-6-one;methane |
| SMILES | C.C=C/C=C(OC)\C(=C/C(=C)C)C(=O)C(/C=C\C=C/C)=C/C |
| InChI | InChI=1S/C19H24O2.CH4/c1-7-10-11-13-16(9-3)19(20)17(14-15(4)5)18(21-6)12-8-2;/h7-14H,2,4H2,1,3,5-6H3;1H4/b10-7-,13-11-,16-9+,17-14+,18-12+; |
| InChIKey | KCGZQYHHKGPXQX-HDGDLHJISA-N |
| XLogP | 5.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|