C29H39N5O5S — CID 143073719
(2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(2S)-1-([1,3]oxazolo[4,5-b]pyridin-2-yl)-1-oxobutan-2-yl]butanamide;2-methylheptane (PubChem CID 143073719) has the molecular formula C29H39N5O5S and a molecular weight of 569.73 g/mol. Its IUPAC name is (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(2S)-1-([1,3]oxazolo[4,5-b]pyridin-2-yl)-1-oxobutan-2-yl]butanamide;2-methylheptane.
| Compound Name | (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(2S)-1-([1,3]oxazolo[4,5-b]pyridin-2-yl)-1-oxobutan-2-yl]butanamide;2-methylheptane |
|---|---|
| PubChem CID | 143073719 |
| Molecular Formula | C29H39N5O5S |
| Molecular Weight | 569.73 g/mol |
| Exact Mass | 569.27 |
| IUPAC Name | (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(2S)-1-([1,3]oxazolo[4,5-b]pyridin-2-yl)-1-oxobutan-2-yl]butanamide;2-methylheptane |
| SMILES | CCCCCC(C)C.CC[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)N[C@@H](CC)C(=O)c1nc2ncccc2o1 |
| InChI | InChI=1S/C21H21N5O5S.C8H18/c1-3-13(17(27)21-25-19-15(31-21)9-7-11-22-19)24-20(28)14(4-2)23-18-12-8-5-6-10-16(12)32(29,30)26-18;1-4-5-6-7-8(2)3/h5-11,13-14H,3-4H2,1-2H3,(H,23,26)(H,24,28);8H,4-7H2,1-3H3/t13-,14-;/m0./s1 |
| InChIKey | XEIGILOUTLMZFK-IODNYQNNSA-N |
| XLogP | 5.04 |
| TPSA | 143.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.73 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|