C27H35N7O3 — CID 143073811
5-[[hydroxy-(morpholin-4-ylamino)methyl]amino]-3-[4-[(4-methylpiperazin-1-yl)methyl]cyclohexa-1,3-dien-1-yl]-1H-indeno[2,1-d]pyrazol-4-one (PubChem CID 143073811) has the molecular formula C27H35N7O3 and a molecular weight of 505.62 g/mol. Its IUPAC name is 5-[[hydroxy-(morpholin-4-ylamino)methyl]amino]-3-[4-[(4-methylpiperazin-1-yl)methyl]cyclohexa-1,3-dien-1-yl]-1H-indeno[2,1-d]pyrazol-4-one.
| Compound Name | 5-[[hydroxy-(morpholin-4-ylamino)methyl]amino]-3-[4-[(4-methylpiperazin-1-yl)methyl]cyclohexa-1,3-dien-1-yl]-1H-indeno[2,1-d]pyrazol-4-one |
|---|---|
| PubChem CID | 143073811 |
| Molecular Formula | C27H35N7O3 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | 5-[[hydroxy-(morpholin-4-ylamino)methyl]amino]-3-[4-[(4-methylpiperazin-1-yl)methyl]cyclohexa-1,3-dien-1-yl]-1H-indeno[2,1-d]pyrazol-4-one |
| SMILES | CN1CCN(CC2=CC=C(c3n[nH]c4c3C(=O)c3c(NC(O)NN5CCOCC5)cccc3-4)CC2)CC1 |
| InChI | InChI=1S/C27H35N7O3/c1-32-9-11-33(12-10-32)17-18-5-7-19(8-6-18)24-23-25(30-29-24)20-3-2-4-21(22(20)26(23)35)28-27(36)31-34-13-15-37-16-14-34/h2-5,7,27-28,31,36H,6,8-17H2,1H3,(H,29,30) |
| InChIKey | JHCAMARSZSSJQZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|