C19H36N2O3 — CID 143073909
N-tert-butylformamide;4-[(3R)-3-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]butanoic acid (PubChem CID 143073909) has the molecular formula C19H36N2O3 and a molecular weight of 340.51 g/mol. Its IUPAC name is N-tert-butylformamide;4-[(3R)-3-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]butanoic acid.
| Compound Name | N-tert-butylformamide;4-[(3R)-3-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]butanoic acid |
|---|---|
| PubChem CID | 143073909 |
| Molecular Formula | C19H36N2O3 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.27 |
| IUPAC Name | N-tert-butylformamide;4-[(3R)-3-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]butanoic acid |
| SMILES | CC(C)(C)NC=O.C[C@@H]1CC2CCCCC2CN1CCCC(=O)O |
| InChI | InChI=1S/C14H25NO2.C5H11NO/c1-11-9-12-5-2-3-6-13(12)10-15(11)8-4-7-14(16)17;1-5(2,3)6-4-7/h11-13H,2-10H2,1H3,(H,16,17);4H,1-3H3,(H,6,7)/t11-,12?,13?;/m1./s1 |
| InChIKey | PKWVMSZISWHPOK-PATAVHRISA-N |
| XLogP | 3.28 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|