C17H16INO3S — CID 143073945
(2S)-2-[(3-hydroxy-2-methylbenzoyl)amino]-3-phenylsulfanylpropanoyl iodide (PubChem CID 143073945) has the molecular formula C17H16INO3S and a molecular weight of 441.29 g/mol. Its IUPAC name is (2S)-2-[(3-hydroxy-2-methylbenzoyl)amino]-3-phenylsulfanylpropanoyl iodide.
| Compound Name | (2S)-2-[(3-hydroxy-2-methylbenzoyl)amino]-3-phenylsulfanylpropanoyl iodide |
|---|---|
| PubChem CID | 143073945 |
| Molecular Formula | C17H16INO3S |
| Molecular Weight | 441.29 g/mol |
| Exact Mass | 440.99 |
| IUPAC Name | (2S)-2-[(3-hydroxy-2-methylbenzoyl)amino]-3-phenylsulfanylpropanoyl iodide |
| SMILES | Cc1c(O)cccc1C(=O)N[C@@H](CSc1ccccc1)C(=O)I |
| InChI | InChI=1S/C17H16INO3S/c1-11-13(8-5-9-15(11)20)17(22)19-14(16(18)21)10-23-12-6-3-2-4-7-12/h2-9,14,20H,10H2,1H3,(H,19,22)/t14-/m0/s1 |
| InChIKey | XABDGQFWIIJILL-AWEZNQCLSA-N |
| XLogP | 3.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|