C16H24N2 — CID 143074040
3,4-bis(ethenyl)-8-(2-methylprop-2-enyl)-2,8-diazaspiro[4.5]dec-3-ene (PubChem CID 143074040) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 3,4-bis(ethenyl)-8-(2-methylprop-2-enyl)-2,8-diazaspiro[4.5]dec-3-ene.
| Compound Name | 3,4-bis(ethenyl)-8-(2-methylprop-2-enyl)-2,8-diazaspiro[4.5]dec-3-ene |
|---|---|
| PubChem CID | 143074040 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 3,4-bis(ethenyl)-8-(2-methylprop-2-enyl)-2,8-diazaspiro[4.5]dec-3-ene |
| SMILES | C=CC1=C(C=C)C2(CCN(CC(=C)C)CC2)CN1 |
| InChI | InChI=1S/C16H24N2/c1-5-14-15(6-2)17-12-16(14)7-9-18(10-8-16)11-13(3)4/h5-6,17H,1-3,7-12H2,4H3 |
| InChIKey | LWCMXCBQVKOIMV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|