About 6-methoxy-1'-prop-2-enylspiro[2,5-dihydro-1H-cyclohepta[b]pyrrole-3,4'-piperidine]
6-methoxy-1'-prop-2-enylspiro[2,5-dihydro-1H-cyclohepta[b]pyrrole-3,4'-piperidine] (PubChem CID 143074247) has the molecular formula C17H24N2O
and a molecular weight of 272.39 g/mol. Its IUPAC name is 6-methoxy-1'-prop-2-enylspiro[2,5-dihydro-1H-cyclohepta[b]pyrrole-3,4'-piperidine].
Molecular Properties
| Compound Name | 6-methoxy-1'-prop-2-enylspiro[2,5-dihydro-1H-cyclohepta[b]pyrrole-3,4'-piperidine] |
| PubChem CID | 143074247 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 6-methoxy-1'-prop-2-enylspiro[2,5-dihydro-1H-cyclohepta[b]pyrrole-3,4'-piperidine] |
| SMILES | C=CCN1CCC2(CC1)CNC1=CC=C(OC)CC=C12 |
| InChI | InChI=1S/C17H24N2O/c1-3-10-19-11-8-17(9-12-19)13-18-16-7-5-14(20-2)4-6-15(16)17/h3,5-7,18H,1,4,8-13H2,2H3 |
| InChIKey | APFZARQOXYUUIE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxy-1'-prop-2-enylspiro[2,5-dihydro-1H-cyclohepta[b]pyrrole-3,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-1'-prop-2-enylspiro[2,5-dihydro-1H-cyclohepta[b]pyrrole-3,4'-piperidine]?
The IUPAC name of 6-methoxy-1'-prop-2-enylspiro[2,5-dihydro-1H-cyclohepta[b]pyrrole-3,4'-piperidine] (CID 143074247) is 6-methoxy-1'-prop-2-enylspiro[2,5-dihydro-1H-cyclohepta[b]pyrrole-3,4'-piperidine].
What is the SMILES notation for 6-methoxy-1'-prop-2-enylspiro[2,5-dihydro-1H-cyclohepta[b]pyrrole-3,4'-piperidine]?
The canonical SMILES for 6-methoxy-1'-prop-2-enylspiro[2,5-dihydro-1H-cyclohepta[b]pyrrole-3,4'-piperidine] is C=CCN1CCC2(CC1)CNC1=CC=C(OC)CC=C12.
What is the InChIKey of 6-methoxy-1'-prop-2-enylspiro[2,5-dihydro-1H-cyclohepta[b]pyrrole-3,4'-piperidine]?
The InChIKey is APFZARQOXYUUIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O/c1-3-10-19-11-8-17(9-12-19)13-18-16-7-5-14(20-2)4-6-15(16)17/h3,5-7,18H,1,4,8-13H2,2H3.
What are the key properties of 6-methoxy-1'-prop-2-enylspiro[2,5-dihydro-1H-cyclohepta[b]pyrrole-3,4'-piperidine]?
6-methoxy-1'-prop-2-enylspiro[2,5-dihydro-1H-cyclohepta[b]pyrrole-3,4'-piperidine] has a molecular weight of 272.39 g/mol, XLogP of 2.60, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-1'-prop-2-enylspiro[2,5-dihydro-1H-cyclohepta[b]pyrrole-3,4'-piperidine] is sourced from PubChem (CID 143074247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).