About 1-[(2,6-difluorophenyl)methylsulfonyl]-3H-indol-2-one
1-[(2,6-difluorophenyl)methylsulfonyl]-3H-indol-2-one (PubChem CID 143074366) has the molecular formula C15H11F2NO3S
and a molecular weight of 323.32 g/mol. Its IUPAC name is 1-[(2,6-difluorophenyl)methylsulfonyl]-3H-indol-2-one.
Molecular Properties
| Compound Name | 1-[(2,6-difluorophenyl)methylsulfonyl]-3H-indol-2-one |
| PubChem CID | 143074366 |
| Molecular Formula | C15H11F2NO3S |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 1-[(2,6-difluorophenyl)methylsulfonyl]-3H-indol-2-one |
| SMILES | O=C1Cc2ccccc2N1S(=O)(=O)Cc1c(F)cccc1F |
| InChI | InChI=1S/C15H11F2NO3S/c16-12-5-3-6-13(17)11(12)9-22(20,21)18-14-7-2-1-4-10(14)8-15(18)19/h1-7H,8-9H2 |
| InChIKey | JJGBSVOVGZWATC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(2,6-difluorophenyl)methylsulfonyl]-3H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,6-difluorophenyl)methylsulfonyl]-3H-indol-2-one?
The IUPAC name of 1-[(2,6-difluorophenyl)methylsulfonyl]-3H-indol-2-one (CID 143074366) is 1-[(2,6-difluorophenyl)methylsulfonyl]-3H-indol-2-one.
What is the SMILES notation for 1-[(2,6-difluorophenyl)methylsulfonyl]-3H-indol-2-one?
The canonical SMILES for 1-[(2,6-difluorophenyl)methylsulfonyl]-3H-indol-2-one is O=C1Cc2ccccc2N1S(=O)(=O)Cc1c(F)cccc1F.
What is the InChIKey of 1-[(2,6-difluorophenyl)methylsulfonyl]-3H-indol-2-one?
The InChIKey is JJGBSVOVGZWATC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F2NO3S/c16-12-5-3-6-13(17)11(12)9-22(20,21)18-14-7-2-1-4-10(14)8-15(18)19/h1-7H,8-9H2.
What are the key properties of 1-[(2,6-difluorophenyl)methylsulfonyl]-3H-indol-2-one?
1-[(2,6-difluorophenyl)methylsulfonyl]-3H-indol-2-one has a molecular weight of 323.32 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,6-difluorophenyl)methylsulfonyl]-3H-indol-2-one is sourced from PubChem (CID 143074366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).