About propane;3-[(propan-2-ylamino)methyl]phenol
propane;3-[(propan-2-ylamino)methyl]phenol (PubChem CID 143074534) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is propane;3-[(propan-2-ylamino)methyl]phenol.
Molecular Properties
| Compound Name | propane;3-[(propan-2-ylamino)methyl]phenol |
| PubChem CID | 143074534 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | propane;3-[(propan-2-ylamino)methyl]phenol |
| SMILES | CC(C)NCc1cccc(O)c1.CCC |
| InChI | InChI=1S/C10H15NO.C3H8/c1-8(2)11-7-9-4-3-5-10(12)6-9;1-3-2/h3-6,8,11-12H,7H2,1-2H3;3H2,1-2H3 |
| InChIKey | YWQNXVKFHOANQB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propane;3-[(propan-2-ylamino)methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;3-[(propan-2-ylamino)methyl]phenol?
The IUPAC name of propane;3-[(propan-2-ylamino)methyl]phenol (CID 143074534) is propane;3-[(propan-2-ylamino)methyl]phenol.
What is the SMILES notation for propane;3-[(propan-2-ylamino)methyl]phenol?
The canonical SMILES for propane;3-[(propan-2-ylamino)methyl]phenol is CC(C)NCc1cccc(O)c1.CCC.
What is the InChIKey of propane;3-[(propan-2-ylamino)methyl]phenol?
The InChIKey is YWQNXVKFHOANQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO.C3H8/c1-8(2)11-7-9-4-3-5-10(12)6-9;1-3-2/h3-6,8,11-12H,7H2,1-2H3;3H2,1-2H3.
What are the key properties of propane;3-[(propan-2-ylamino)methyl]phenol?
propane;3-[(propan-2-ylamino)methyl]phenol has a molecular weight of 209.33 g/mol, XLogP of 3.31, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propane;3-[(propan-2-ylamino)methyl]phenol is sourced from PubChem (CID 143074534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).