C22H37N3O2S2 — CID 143074734
(Z)-1-N',1-N'-dicyclohexyl-1-N-(5-ethylsulfanyl-1,3-thiazol-2-yl)but-1-ene-1,1-diamine;formic acid (PubChem CID 143074734) has the molecular formula C22H37N3O2S2 and a molecular weight of 439.69 g/mol. Its IUPAC name is (Z)-1-N',1-N'-dicyclohexyl-1-N-(5-ethylsulfanyl-1,3-thiazol-2-yl)but-1-ene-1,1-diamine;formic acid.
| Compound Name | (Z)-1-N',1-N'-dicyclohexyl-1-N-(5-ethylsulfanyl-1,3-thiazol-2-yl)but-1-ene-1,1-diamine;formic acid |
|---|---|
| PubChem CID | 143074734 |
| Molecular Formula | C22H37N3O2S2 |
| Molecular Weight | 439.69 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | (Z)-1-N',1-N'-dicyclohexyl-1-N-(5-ethylsulfanyl-1,3-thiazol-2-yl)but-1-ene-1,1-diamine;formic acid |
| SMILES | CC/C=C(/Nc1ncc(SCC)s1)N(C1CCCCC1)C1CCCCC1.O=CO |
| InChI | InChI=1S/C21H35N3S2.CH2O2/c1-3-11-19(23-21-22-16-20(26-21)25-4-2)24(17-12-7-5-8-13-17)18-14-9-6-10-15-18;2-1-3/h11,16-18H,3-10,12-15H2,1-2H3,(H,22,23);1H,(H,2,3)/b19-11-; |
| InChIKey | UPKSCPOKJGYLSZ-XHFAFUTOSA-N |
| XLogP | 6.59 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.69 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|