C29H45N5OS2 — CID 143074934
1,1-dicyclohexyl-3-[5-[[4-[(2E)-octa-2,4,7-trien-3-yl]sulfanylpiperazin-1-yl]methyl]-1,3-thiazol-2-yl]urea (PubChem CID 143074934) has the molecular formula C29H45N5OS2 and a molecular weight of 543.85 g/mol. Its IUPAC name is 1,1-dicyclohexyl-3-[5-[[4-[(2E)-octa-2,4,7-trien-3-yl]sulfanylpiperazin-1-yl]methyl]-1,3-thiazol-2-yl]urea.
| Compound Name | 1,1-dicyclohexyl-3-[5-[[4-[(2E)-octa-2,4,7-trien-3-yl]sulfanylpiperazin-1-yl]methyl]-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 143074934 |
| Molecular Formula | C29H45N5OS2 |
| Molecular Weight | 543.85 g/mol |
| Exact Mass | 543.31 |
| IUPAC Name | 1,1-dicyclohexyl-3-[5-[[4-[(2E)-octa-2,4,7-trien-3-yl]sulfanylpiperazin-1-yl]methyl]-1,3-thiazol-2-yl]urea |
| SMILES | C=CCC=C/C(=C\C)SN1CCN(Cc2cnc(NC(=O)N(C3CCCCC3)C3CCCCC3)s2)CC1 |
| InChI | InChI=1S/C29H45N5OS2/c1-3-5-8-17-26(4-2)37-33-20-18-32(19-21-33)23-27-22-30-28(36-27)31-29(35)34(24-13-9-6-10-14-24)25-15-11-7-12-16-25/h3-4,8,17,22,24-25H,1,5-7,9-16,18-21,23H2,2H3,(H,30,31,35)/b17-8?,26-4+ |
| InChIKey | DXCUGUIJGJVGTP-SHEWYNSCSA-N |
| XLogP | 7.44 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.85 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|