C29H55NO2 — CID 143074976
N-tert-butyl-3a,6,7-trimethyl-6-(3-oxobutyl)-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalene-3-carboxamide;ethane (PubChem CID 143074976) has the molecular formula C29H55NO2 and a molecular weight of 449.76 g/mol. Its IUPAC name is N-tert-butyl-3a,6,7-trimethyl-6-(3-oxobutyl)-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalene-3-carboxamide;ethane.
| Compound Name | N-tert-butyl-3a,6,7-trimethyl-6-(3-oxobutyl)-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalene-3-carboxamide;ethane |
|---|---|
| PubChem CID | 143074976 |
| Molecular Formula | C29H55NO2 |
| Molecular Weight | 449.76 g/mol |
| Exact Mass | 449.42 |
| IUPAC Name | N-tert-butyl-3a,6,7-trimethyl-6-(3-oxobutyl)-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalene-3-carboxamide;ethane |
| SMILES | CC.CC.CC(=O)CCC1(C)C(C)CCC2C1CCC1(C)C(C(=O)NC(C)(C)C)CCC21 |
| InChI | InChI=1S/C25H43NO2.2C2H6/c1-16-8-9-18-19-10-11-21(22(28)26-23(3,4)5)25(19,7)15-13-20(18)24(16,6)14-12-17(2)27;2*1-2/h16,18-21H,8-15H2,1-7H3,(H,26,28);2*1-2H3 |
| InChIKey | DGEPYIUVWFVVKC-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.76 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |