C25H43NO2 — CID 143074977
N-tert-butyl-3a,6,7-trimethyl-6-(3-oxobutyl)-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalene-3-carboxamide (PubChem CID 143074977) has the molecular formula C25H43NO2 and a molecular weight of 389.62 g/mol. Its IUPAC name is N-tert-butyl-3a,6,7-trimethyl-6-(3-oxobutyl)-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalene-3-carboxamide.
| Compound Name | N-tert-butyl-3a,6,7-trimethyl-6-(3-oxobutyl)-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalene-3-carboxamide |
|---|---|
| PubChem CID | 143074977 |
| Molecular Formula | C25H43NO2 |
| Molecular Weight | 389.62 g/mol |
| Exact Mass | 389.33 |
| IUPAC Name | N-tert-butyl-3a,6,7-trimethyl-6-(3-oxobutyl)-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalene-3-carboxamide |
| SMILES | CC(=O)CCC1(C)C(C)CCC2C1CCC1(C)C(C(=O)NC(C)(C)C)CCC21 |
| InChI | InChI=1S/C25H43NO2/c1-16-8-9-18-19-10-11-21(22(28)26-23(3,4)5)25(19,7)15-13-20(18)24(16,6)14-12-17(2)27/h16,18-21H,8-15H2,1-7H3,(H,26,28) |
| InChIKey | DQNSZPPVGBBBRM-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.62 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |