C17H27FN4 — CID 143074980
4-[3-[(2E,7Z)-6-fluoronona-2,4,7-trien-2-yl]-5-methyl-1,2,4-triazol-1-yl]-2-methylbutan-2-amine (PubChem CID 143074980) has the molecular formula C17H27FN4 and a molecular weight of 306.43 g/mol. Its IUPAC name is 4-[3-[(2E,7Z)-6-fluoronona-2,4,7-trien-2-yl]-5-methyl-1,2,4-triazol-1-yl]-2-methylbutan-2-amine.
| Compound Name | 4-[3-[(2E,7Z)-6-fluoronona-2,4,7-trien-2-yl]-5-methyl-1,2,4-triazol-1-yl]-2-methylbutan-2-amine |
|---|---|
| PubChem CID | 143074980 |
| Molecular Formula | C17H27FN4 |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 4-[3-[(2E,7Z)-6-fluoronona-2,4,7-trien-2-yl]-5-methyl-1,2,4-triazol-1-yl]-2-methylbutan-2-amine |
| SMILES | C/C=C\C(F)C=C/C=C(\C)c1nc(C)n(CCC(C)(C)N)n1 |
| InChI | InChI=1S/C17H27FN4/c1-6-8-15(18)10-7-9-13(2)16-20-14(3)22(21-16)12-11-17(4,5)19/h6-10,15H,11-12,19H2,1-5H3/b8-6-,10-7?,13-9+ |
| InChIKey | PQCUGZFBNBJZHI-CNZCKOKYSA-N |
| XLogP | 3.59 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|