C21H33N5O4S2 — CID 143076446
1-N'-[5-[tert-butyl(methyl)sulfamoyl]-4-hydroxythiophen-3-yl]-2-N'-[(1R)-1-(4,5-dimethylfuran-2-yl)-2-methylpropyl]ethanediimidamide (PubChem CID 143076446) has the molecular formula C21H33N5O4S2 and a molecular weight of 483.66 g/mol. Its IUPAC name is 1-N'-[5-[tert-butyl(methyl)sulfamoyl]-4-hydroxythiophen-3-yl]-2-N'-[(1R)-1-(4,5-dimethylfuran-2-yl)-2-methylpropyl]ethanediimidamide.
| Compound Name | 1-N'-[5-[tert-butyl(methyl)sulfamoyl]-4-hydroxythiophen-3-yl]-2-N'-[(1R)-1-(4,5-dimethylfuran-2-yl)-2-methylpropyl]ethanediimidamide |
|---|---|
| PubChem CID | 143076446 |
| Molecular Formula | C21H33N5O4S2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 1-N'-[5-[tert-butyl(methyl)sulfamoyl]-4-hydroxythiophen-3-yl]-2-N'-[(1R)-1-(4,5-dimethylfuran-2-yl)-2-methylpropyl]ethanediimidamide |
| SMILES | Cc1cc([C@H](/N=C(N)/C(N)=N/c2csc(S(=O)(=O)N(C)C(C)(C)C)c2O)C(C)C)oc1C |
| InChI | InChI=1S/C21H33N5O4S2/c1-11(2)16(15-9-12(3)13(4)30-15)25-19(23)18(22)24-14-10-31-20(17(14)27)32(28,29)26(8)21(5,6)7/h9-11,16,27H,1-8H3,(H2,22,24)(H2,23,25)/t16-/m1/s1 |
| InChIKey | DBOXNLWCDWTMNN-MRXNPFEDSA-N |
| XLogP | 3.83 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|