C12H18N4O4S3 — CID 143076521
N-tert-butyl-4-[(4-ethoxy-1,2,5-thiadiazol-3-yl)amino]-3-hydroxythiophene-2-sulfonamide (PubChem CID 143076521) has the molecular formula C12H18N4O4S3 and a molecular weight of 378.50 g/mol. Its IUPAC name is N-tert-butyl-4-[(4-ethoxy-1,2,5-thiadiazol-3-yl)amino]-3-hydroxythiophene-2-sulfonamide.
| Compound Name | N-tert-butyl-4-[(4-ethoxy-1,2,5-thiadiazol-3-yl)amino]-3-hydroxythiophene-2-sulfonamide |
|---|---|
| PubChem CID | 143076521 |
| Molecular Formula | C12H18N4O4S3 |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | N-tert-butyl-4-[(4-ethoxy-1,2,5-thiadiazol-3-yl)amino]-3-hydroxythiophene-2-sulfonamide |
| SMILES | CCOc1nsnc1Nc1csc(S(=O)(=O)NC(C)(C)C)c1O |
| InChI | InChI=1S/C12H18N4O4S3/c1-5-20-10-9(14-22-15-10)13-7-6-21-11(8(7)17)23(18,19)16-12(2,3)4/h6,16-17H,5H2,1-4H3,(H,13,14) |
| InChIKey | IXBGTUGPTHIRFR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|