About 1-phenyl-N-[(1S)-2,2,2-trifluoro-1-(furan-2-yl)ethyl]ethanimine;propane
1-phenyl-N-[(1S)-2,2,2-trifluoro-1-(furan-2-yl)ethyl]ethanimine;propane (PubChem CID 143076602) has the molecular formula C17H20F3NO
and a molecular weight of 311.35 g/mol. Its IUPAC name is 1-phenyl-N-[(1S)-2,2,2-trifluoro-1-(furan-2-yl)ethyl]ethanimine;propane.
Molecular Properties
| Compound Name | 1-phenyl-N-[(1S)-2,2,2-trifluoro-1-(furan-2-yl)ethyl]ethanimine;propane |
| PubChem CID | 143076602 |
| Molecular Formula | C17H20F3NO |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 1-phenyl-N-[(1S)-2,2,2-trifluoro-1-(furan-2-yl)ethyl]ethanimine;propane |
| SMILES | C/C(=N\[C@@H](c1ccco1)C(F)(F)F)c1ccccc1.CCC |
| InChI | InChI=1S/C14H12F3NO.C3H8/c1-10(11-6-3-2-4-7-11)18-13(14(15,16)17)12-8-5-9-19-12;1-3-2/h2-9,13H,1H3;3H2,1-2H3/b18-10+;/t13-;/m0./s1 |
| InChIKey | CPRVNFPVXSKKFL-BXNHVGFHSA-N |
| XLogP | 5.81 |
| TPSA | 25.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-N-[(1S)-2,2,2-trifluoro-1-(furan-2-yl)ethyl]ethanimine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-N-[(1S)-2,2,2-trifluoro-1-(furan-2-yl)ethyl]ethanimine;propane?
The IUPAC name of 1-phenyl-N-[(1S)-2,2,2-trifluoro-1-(furan-2-yl)ethyl]ethanimine;propane (CID 143076602) is 1-phenyl-N-[(1S)-2,2,2-trifluoro-1-(furan-2-yl)ethyl]ethanimine;propane.
What is the SMILES notation for 1-phenyl-N-[(1S)-2,2,2-trifluoro-1-(furan-2-yl)ethyl]ethanimine;propane?
The canonical SMILES for 1-phenyl-N-[(1S)-2,2,2-trifluoro-1-(furan-2-yl)ethyl]ethanimine;propane is C/C(=N\[C@@H](c1ccco1)C(F)(F)F)c1ccccc1.CCC.
What is the InChIKey of 1-phenyl-N-[(1S)-2,2,2-trifluoro-1-(furan-2-yl)ethyl]ethanimine;propane?
The InChIKey is CPRVNFPVXSKKFL-BXNHVGFHSA-N. The full InChI is InChI=1S/C14H12F3NO.C3H8/c1-10(11-6-3-2-4-7-11)18-13(14(15,16)17)12-8-5-9-19-12;1-3-2/h2-9,13H,1H3;3H2,1-2H3/b18-10+;/t13-;/m0./s1.
What are the key properties of 1-phenyl-N-[(1S)-2,2,2-trifluoro-1-(furan-2-yl)ethyl]ethanimine;propane?
1-phenyl-N-[(1S)-2,2,2-trifluoro-1-(furan-2-yl)ethyl]ethanimine;propane has a molecular weight of 311.35 g/mol, XLogP of 5.81, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-N-[(1S)-2,2,2-trifluoro-1-(furan-2-yl)ethyl]ethanimine;propane is sourced from PubChem (CID 143076602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).