About (2E,4E)-3-amino-5-methylhepta-2,4-dien-4-ol
(2E,4E)-3-amino-5-methylhepta-2,4-dien-4-ol (PubChem CID 143076663) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is (2E,4E)-3-amino-5-methylhepta-2,4-dien-4-ol.
Molecular Properties
| Compound Name | (2E,4E)-3-amino-5-methylhepta-2,4-dien-4-ol |
| PubChem CID | 143076663 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | (2E,4E)-3-amino-5-methylhepta-2,4-dien-4-ol |
| SMILES | C/C=C(N)\C(O)=C(\C)CC |
| InChI | InChI=1S/C8H15NO/c1-4-6(3)8(10)7(9)5-2/h5,10H,4,9H2,1-3H3/b7-5+,8-6+ |
| InChIKey | ZGFMXATYOBSBQF-KQQUZDAGSA-N |
| XLogP | 2.09 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-3-amino-5-methylhepta-2,4-dien-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-3-amino-5-methylhepta-2,4-dien-4-ol?
The IUPAC name of (2E,4E)-3-amino-5-methylhepta-2,4-dien-4-ol (CID 143076663) is (2E,4E)-3-amino-5-methylhepta-2,4-dien-4-ol.
What is the SMILES notation for (2E,4E)-3-amino-5-methylhepta-2,4-dien-4-ol?
The canonical SMILES for (2E,4E)-3-amino-5-methylhepta-2,4-dien-4-ol is C/C=C(N)\C(O)=C(\C)CC.
What is the InChIKey of (2E,4E)-3-amino-5-methylhepta-2,4-dien-4-ol?
The InChIKey is ZGFMXATYOBSBQF-KQQUZDAGSA-N. The full InChI is InChI=1S/C8H15NO/c1-4-6(3)8(10)7(9)5-2/h5,10H,4,9H2,1-3H3/b7-5+,8-6+.
What are the key properties of (2E,4E)-3-amino-5-methylhepta-2,4-dien-4-ol?
(2E,4E)-3-amino-5-methylhepta-2,4-dien-4-ol has a molecular weight of 141.21 g/mol, XLogP of 2.09, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-3-amino-5-methylhepta-2,4-dien-4-ol is sourced from PubChem (CID 143076663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).