About 5-[(2R)-but-3-yn-2-yl]-2,3-dimethylfuran
5-[(2R)-but-3-yn-2-yl]-2,3-dimethylfuran (PubChem CID 143076954) has the molecular formula C10H12O
and a molecular weight of 148.20 g/mol. Its IUPAC name is 5-[(2R)-but-3-yn-2-yl]-2,3-dimethylfuran.
Molecular Properties
| Compound Name | 5-[(2R)-but-3-yn-2-yl]-2,3-dimethylfuran |
| PubChem CID | 143076954 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 5-[(2R)-but-3-yn-2-yl]-2,3-dimethylfuran |
| SMILES | C#C[C@@H](C)c1cc(C)c(C)o1 |
| InChI | InChI=1S/C10H12O/c1-5-7(2)10-6-8(3)9(4)11-10/h1,6-7H,2-4H3/t7-/m1/s1 |
| InChIKey | ITXYZKXSUGVZOQ-SSDOTTSWSA-N |
| XLogP | 2.63 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2R)-but-3-yn-2-yl]-2,3-dimethylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2R)-but-3-yn-2-yl]-2,3-dimethylfuran?
The IUPAC name of 5-[(2R)-but-3-yn-2-yl]-2,3-dimethylfuran (CID 143076954) is 5-[(2R)-but-3-yn-2-yl]-2,3-dimethylfuran.
What is the SMILES notation for 5-[(2R)-but-3-yn-2-yl]-2,3-dimethylfuran?
The canonical SMILES for 5-[(2R)-but-3-yn-2-yl]-2,3-dimethylfuran is C#C[C@@H](C)c1cc(C)c(C)o1.
What is the InChIKey of 5-[(2R)-but-3-yn-2-yl]-2,3-dimethylfuran?
The InChIKey is ITXYZKXSUGVZOQ-SSDOTTSWSA-N. The full InChI is InChI=1S/C10H12O/c1-5-7(2)10-6-8(3)9(4)11-10/h1,6-7H,2-4H3/t7-/m1/s1.
What are the key properties of 5-[(2R)-but-3-yn-2-yl]-2,3-dimethylfuran?
5-[(2R)-but-3-yn-2-yl]-2,3-dimethylfuran has a molecular weight of 148.20 g/mol, XLogP of 2.63, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2R)-but-3-yn-2-yl]-2,3-dimethylfuran is sourced from PubChem (CID 143076954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).