C26H31N7O2+2 — CID 143076958
[1,2-diamino-2-(2,3-dimethylphenyl)azaniumylideneethylidene]-[2-hydroxy-3-(4-pyridin-2-ylpiperazine-1-carbonyl)phenyl]azanium (PubChem CID 143076958) has the molecular formula C26H31N7O2+2 and a molecular weight of 473.58 g/mol. Its IUPAC name is [1,2-diamino-2-(2,3-dimethylphenyl)azaniumylideneethylidene]-[2-hydroxy-3-(4-pyridin-2-ylpiperazine-1-carbonyl)phenyl]azanium.
| Compound Name | [1,2-diamino-2-(2,3-dimethylphenyl)azaniumylideneethylidene]-[2-hydroxy-3-(4-pyridin-2-ylpiperazine-1-carbonyl)phenyl]azanium |
|---|---|
| PubChem CID | 143076958 |
| Molecular Formula | C26H31N7O2+2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | [1,2-diamino-2-(2,3-dimethylphenyl)azaniumylideneethylidene]-[2-hydroxy-3-(4-pyridin-2-ylpiperazine-1-carbonyl)phenyl]azanium |
| SMILES | Cc1cccc(/[NH+]=C(N)/C(N)=[NH+]/c2cccc(C(=O)N3CCN(c4ccccn4)CC3)c2O)c1C |
| InChI | InChI=1S/C26H29N7O2/c1-17-7-5-9-20(18(17)2)30-24(27)25(28)31-21-10-6-8-19(23(21)34)26(35)33-15-13-32(14-16-33)22-11-3-4-12-29-22/h3-12,34H,13-16H2,1-2H3,(H2,27,30)(H2,28,31)/p+2 |
| InChIKey | NUASDBGPVZXORW-UHFFFAOYSA-P |
| XLogP | -0.79 |
| TPSA | 136.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|